C18H20O4 — CID 139611178
propan-2-yl 2,2-bis(4-hydroxyphenyl)propanoate (PubChem CID 139611178) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is propan-2-yl 2,2-bis(4-hydroxyphenyl)propanoate.
| Compound Name | propan-2-yl 2,2-bis(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 139611178 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | propan-2-yl 2,2-bis(4-hydroxyphenyl)propanoate |
| SMILES | CC(C)OC(=O)C(C)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O4/c1-12(2)22-17(21)18(3,13-4-8-15(19)9-5-13)14-6-10-16(20)11-7-14/h4-12,19-20H,1-3H3 |
| InChIKey | APNFPVAYULVFMH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |