About zinc propan-2-yl 4-hydroxybenzoate
zinc propan-2-yl 4-hydroxybenzoate (PubChem CID 54602710) has the molecular formula C10H12O3Zn+2
and a molecular weight of 245.59 g/mol. Its IUPAC name is zinc propan-2-yl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | zinc propan-2-yl 4-hydroxybenzoate |
| PubChem CID | 54602710 |
| Molecular Formula | C10H12O3Zn+2 |
| Molecular Weight | 245.59 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | zinc propan-2-yl 4-hydroxybenzoate |
| SMILES | CC(C)OC(=O)c1ccc(O)cc1.[Zn+2] |
| InChI | InChI=1S/C10H12O3.Zn/c1-7(2)13-10(12)8-3-5-9(11)6-4-8;/h3-7,11H,1-2H3;/q;+2 |
| InChIKey | HEVMLLCEBWXMOZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc propan-2-yl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc propan-2-yl 4-hydroxybenzoate?
The IUPAC name of zinc propan-2-yl 4-hydroxybenzoate (CID 54602710) is zinc propan-2-yl 4-hydroxybenzoate.
What is the SMILES notation for zinc propan-2-yl 4-hydroxybenzoate?
The canonical SMILES for zinc propan-2-yl 4-hydroxybenzoate is CC(C)OC(=O)c1ccc(O)cc1.[Zn+2].
What is the InChIKey of zinc propan-2-yl 4-hydroxybenzoate?
The InChIKey is HEVMLLCEBWXMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3.Zn/c1-7(2)13-10(12)8-3-5-9(11)6-4-8;/h3-7,11H,1-2H3;/q;+2.
What are the key properties of zinc propan-2-yl 4-hydroxybenzoate?
zinc propan-2-yl 4-hydroxybenzoate has a molecular weight of 245.59 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc propan-2-yl 4-hydroxybenzoate is sourced from PubChem (CID 54602710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).