About propan-2-yl 4-acetylbenzoate
propan-2-yl 4-acetylbenzoate (PubChem CID 10878303) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is propan-2-yl 4-acetylbenzoate.
Molecular Properties
| Compound Name | propan-2-yl 4-acetylbenzoate |
| PubChem CID | 10878303 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | propan-2-yl 4-acetylbenzoate |
| SMILES | CC(=O)c1ccc(C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C12H14O3/c1-8(2)15-12(14)11-6-4-10(5-7-11)9(3)13/h4-8H,1-3H3 |
| InChIKey | DQQVADFLIZSTDK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 4-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-acetylbenzoate?
The IUPAC name of propan-2-yl 4-acetylbenzoate (CID 10878303) is propan-2-yl 4-acetylbenzoate.
What is the SMILES notation for propan-2-yl 4-acetylbenzoate?
The canonical SMILES for propan-2-yl 4-acetylbenzoate is CC(=O)c1ccc(C(=O)OC(C)C)cc1.
What is the InChIKey of propan-2-yl 4-acetylbenzoate?
The InChIKey is DQQVADFLIZSTDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-8(2)15-12(14)11-6-4-10(5-7-11)9(3)13/h4-8H,1-3H3.
What are the key properties of propan-2-yl 4-acetylbenzoate?
propan-2-yl 4-acetylbenzoate has a molecular weight of 206.24 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-acetylbenzoate is sourced from PubChem (CID 10878303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).