About [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate
[3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate (PubChem CID 144833669) has the molecular formula C22H24O4
and a molecular weight of 352.43 g/mol. Its IUPAC name is [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate.
Molecular Properties
| Compound Name | [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate |
| PubChem CID | 144833669 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate |
| SMILES | CC(=O)c1ccc(C(=O)OC(C)C(C)(C)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H24O4/c1-14-6-8-18(9-7-14)20(24)22(4,5)16(3)26-21(25)19-12-10-17(11-13-19)15(2)23/h6-13,16H,1-5H3 |
| InChIKey | HLTSYIOTPHCEAM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate?
The IUPAC name of [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate (CID 144833669) is [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate.
What is the SMILES notation for [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate?
The canonical SMILES for [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate is CC(=O)c1ccc(C(=O)OC(C)C(C)(C)C(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate?
The InChIKey is HLTSYIOTPHCEAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O4/c1-14-6-8-18(9-7-14)20(24)22(4,5)16(3)26-21(25)19-12-10-17(11-13-19)15(2)23/h6-13,16H,1-5H3.
What are the key properties of [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate?
[3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate has a molecular weight of 352.43 g/mol, XLogP of 4.65, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-dimethyl-4-(4-methylphenyl)-4-oxobutan-2-yl] 4-acetylbenzoate is sourced from PubChem (CID 144833669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).