4-(2-phenylphenyl)benzoyl chloride

C19H13ClO — CID 141290738

IUPAC4-(2-phenylphenyl)benzoyl chloride
SMILESO=C(Cl)c1ccc(-c2ccccc2-c2ccccc2)cc1
InChIInChI=1S/C19H13ClO/c20-19(21)16-12-10-15(11-13-16)18-9-5-4-8-17(18)14-6-2-1-3-7-14/h1-13H
InChIKeyOCTDBIJJSCPBKX-UHFFFAOYSA-N
MW292.77 g/mol
LogP5.40
Rot. Bonds3

About 4-(2-phenylphenyl)benzoyl chloride

4-(2-phenylphenyl)benzoyl chloride (PubChem CID 141290738) has the molecular formula C19H13ClO and a molecular weight of 292.77 g/mol. Its IUPAC name is 4-(2-phenylphenyl)benzoyl chloride.

Molecular Properties

Compound Name4-(2-phenylphenyl)benzoyl chloride
PubChem CID141290738
Molecular FormulaC19H13ClO
Molecular Weight292.77 g/mol
Exact Mass292.07
IUPAC Name4-(2-phenylphenyl)benzoyl chloride
SMILESO=C(Cl)c1ccc(-c2ccccc2-c2ccccc2)cc1
InChIInChI=1S/C19H13ClO/c20-19(21)16-12-10-15(11-13-16)18-9-5-4-8-17(18)14-6-2-1-3-7-14/h1-13H
InChIKeyOCTDBIJJSCPBKX-UHFFFAOYSA-N
XLogP5.40
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500292.77
LogP ≤ 55.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-(2-phenylphenyl)benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-phenylphenyl)benzoyl chloride?
The IUPAC name of 4-(2-phenylphenyl)benzoyl chloride (CID 141290738) is 4-(2-phenylphenyl)benzoyl chloride.
What is the SMILES notation for 4-(2-phenylphenyl)benzoyl chloride?
The canonical SMILES for 4-(2-phenylphenyl)benzoyl chloride is O=C(Cl)c1ccc(-c2ccccc2-c2ccccc2)cc1.
What is the InChIKey of 4-(2-phenylphenyl)benzoyl chloride?
The InChIKey is OCTDBIJJSCPBKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClO/c20-19(21)16-12-10-15(11-13-16)18-9-5-4-8-17(18)14-6-2-1-3-7-14/h1-13H.
What are the key properties of 4-(2-phenylphenyl)benzoyl chloride?
4-(2-phenylphenyl)benzoyl chloride has a molecular weight of 292.77 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-phenylphenyl)benzoyl chloride is sourced from PubChem (CID 141290738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).