About 3-amino-4-phenylbenzoyl chloride
3-amino-4-phenylbenzoyl chloride (PubChem CID 162734876) has the molecular formula C13H10ClNO
and a molecular weight of 231.68 g/mol. Its IUPAC name is 3-amino-4-phenylbenzoyl chloride.
Molecular Properties
| Compound Name | 3-amino-4-phenylbenzoyl chloride |
| PubChem CID | 162734876 |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-amino-4-phenylbenzoyl chloride |
| SMILES | Nc1cc(C(=O)Cl)ccc1-c1ccccc1 |
| InChI | InChI=1S/C13H10ClNO/c14-13(16)10-6-7-11(12(15)8-10)9-4-2-1-3-5-9/h1-8H,15H2 |
| InChIKey | DUWDZHJRXMVDEM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-phenylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-phenylbenzoyl chloride?
The IUPAC name of 3-amino-4-phenylbenzoyl chloride (CID 162734876) is 3-amino-4-phenylbenzoyl chloride.
What is the SMILES notation for 3-amino-4-phenylbenzoyl chloride?
The canonical SMILES for 3-amino-4-phenylbenzoyl chloride is Nc1cc(C(=O)Cl)ccc1-c1ccccc1.
What is the InChIKey of 3-amino-4-phenylbenzoyl chloride?
The InChIKey is DUWDZHJRXMVDEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO/c14-13(16)10-6-7-11(12(15)8-10)9-4-2-1-3-5-9/h1-8H,15H2.
What are the key properties of 3-amino-4-phenylbenzoyl chloride?
3-amino-4-phenylbenzoyl chloride has a molecular weight of 231.68 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-phenylbenzoyl chloride is sourced from PubChem (CID 162734876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).