C14H6Cl2O2 — CID 59041868
biphenylene-2,7-dicarbonyl chloride (PubChem CID 59041868) has the molecular formula C14H6Cl2O2 and a molecular weight of 277.11 g/mol. Its IUPAC name is biphenylene-2,7-dicarbonyl chloride.
| Compound Name | biphenylene-2,7-dicarbonyl chloride |
|---|---|
| PubChem CID | 59041868 |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | biphenylene-2,7-dicarbonyl chloride |
| SMILES | O=C(Cl)c1ccc2c(c1)-c1cc(C(=O)Cl)ccc1-2 |
| InChI | InChI=1S/C14H6Cl2O2/c15-13(17)7-1-3-9-10-4-2-8(14(16)18)6-12(10)11(9)5-7/h1-6H |
| InChIKey | DADODFWWCPKUOX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|