C16H7Cl2NO4 — CID 3557802
2-(4-carbonochloridoylphenyl)-1,3-dioxoisoindole-5-carbonyl chloride (PubChem CID 3557802) has the molecular formula C16H7Cl2NO4 and a molecular weight of 348.14 g/mol. Its IUPAC name is 2-(4-carbonochloridoylphenyl)-1,3-dioxoisoindole-5-carbonyl chloride.
| Compound Name | 2-(4-carbonochloridoylphenyl)-1,3-dioxoisoindole-5-carbonyl chloride |
|---|---|
| PubChem CID | 3557802 |
| Molecular Formula | C16H7Cl2NO4 |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-(4-carbonochloridoylphenyl)-1,3-dioxoisoindole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc(N2C(=O)c3ccc(C(=O)Cl)cc3C2=O)cc1 |
| InChI | InChI=1S/C16H7Cl2NO4/c17-13(20)8-1-4-10(5-2-8)19-15(22)11-6-3-9(14(18)21)7-12(11)16(19)23/h1-7H |
| InChIKey | WNTCBSPRQOPMMJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|