C32H18Cl2N2O6 — CID 155899332
2-[4-[4-(5-carbonochloridoyl-1,3-dioxoisoindol-2-yl)-2-methylphenyl]-3-methylphenyl]-1,3-dioxoisoindole-5-carbonyl chloride (PubChem CID 155899332) has the molecular formula C32H18Cl2N2O6 and a molecular weight of 597.41 g/mol. Its IUPAC name is 2-[4-[4-(5-carbonochloridoyl-1,3-dioxoisoindol-2-yl)-2-methylphenyl]-3-methylphenyl]-1,3-dioxoisoindole-5-carbonyl chloride.
| Compound Name | 2-[4-[4-(5-carbonochloridoyl-1,3-dioxoisoindol-2-yl)-2-methylphenyl]-3-methylphenyl]-1,3-dioxoisoindole-5-carbonyl chloride |
|---|---|
| PubChem CID | 155899332 |
| Molecular Formula | C32H18Cl2N2O6 |
| Molecular Weight | 597.41 g/mol |
| Exact Mass | 596.05 |
| IUPAC Name | 2-[4-[4-(5-carbonochloridoyl-1,3-dioxoisoindol-2-yl)-2-methylphenyl]-3-methylphenyl]-1,3-dioxoisoindole-5-carbonyl chloride |
| SMILES | Cc1cc(N2C(=O)c3ccc(C(=O)Cl)cc3C2=O)ccc1-c1ccc(N2C(=O)c3ccc(C(=O)Cl)cc3C2=O)cc1C |
| InChI | InChI=1S/C32H18Cl2N2O6/c1-15-11-19(35-29(39)23-7-3-17(27(33)37)13-25(23)31(35)41)5-9-21(15)22-10-6-20(12-16(22)2)36-30(40)24-8-4-18(28(34)38)14-26(24)32(36)42/h3-14H,1-2H3 |
| InChIKey | NMXANUDIHJTOKA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.41 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|