C30H23NO4 — CID 126188546
benzhydryl 2-(3,4-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126188546) has the molecular formula C30H23NO4 and a molecular weight of 461.52 g/mol. Its IUPAC name is benzhydryl 2-(3,4-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | benzhydryl 2-(3,4-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126188546 |
| Molecular Formula | C30H23NO4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | benzhydryl 2-(3,4-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)OC(c4ccccc4)c4ccccc4)cc3C2=O)cc1C |
| InChI | InChI=1S/C30H23NO4/c1-19-13-15-24(17-20(19)2)31-28(32)25-16-14-23(18-26(25)29(31)33)30(34)35-27(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-18,27H,1-2H3 |
| InChIKey | KFGWXRTYTHPLEW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|