C25H18ClNO5 — CID 2902217
(1-oxo-1-phenylpropan-2-yl) 2-(3-chloro-4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2902217) has the molecular formula C25H18ClNO5 and a molecular weight of 447.87 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 2-(3-chloro-4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 2-(3-chloro-4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2902217 |
| Molecular Formula | C25H18ClNO5 |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 2-(3-chloro-4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)OC(C)C(=O)c4ccccc4)cc3C2=O)cc1Cl |
| InChI | InChI=1S/C25H18ClNO5/c1-14-8-10-18(13-21(14)26)27-23(29)19-11-9-17(12-20(19)24(27)30)25(31)32-15(2)22(28)16-6-4-3-5-7-16/h3-13,15H,1-2H3 |
| InChIKey | ZTEJGVYBMZATMC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|