C31H22ClNO5S — CID 4092095
[1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4092095) has the molecular formula C31H22ClNO5S and a molecular weight of 556.04 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4092095 |
| Molecular Formula | C31H22ClNO5S |
| Molecular Weight | 556.04 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | [1-(3-chlorophenyl)-1-oxopropan-2-yl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(Sc2ccc(N3C(=O)c4ccc(C(=O)OC(C)C(=O)c5cccc(Cl)c5)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C31H22ClNO5S/c1-18-6-11-24(12-7-18)39-25-13-9-23(10-14-25)33-29(35)26-15-8-21(17-27(26)30(33)36)31(37)38-19(2)28(34)20-4-3-5-22(32)16-20/h3-17,19H,1-2H3 |
| InChIKey | NASMEIWCWFBQCF-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.04 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|