C33H27NO5S — CID 5058968
(1-oxo-1-phenylpentan-2-yl) 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 5058968) has the molecular formula C33H27NO5S and a molecular weight of 549.65 g/mol. Its IUPAC name is (1-oxo-1-phenylpentan-2-yl) 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (1-oxo-1-phenylpentan-2-yl) 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 5058968 |
| Molecular Formula | C33H27NO5S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | (1-oxo-1-phenylpentan-2-yl) 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCC(OC(=O)c1ccc2c(c1)C(=O)N(c1ccc(Sc3ccc(C)cc3)cc1)C2=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C33H27NO5S/c1-3-7-29(30(35)22-8-5-4-6-9-22)39-33(38)23-12-19-27-28(20-23)32(37)34(31(27)36)24-13-17-26(18-14-24)40-25-15-10-21(2)11-16-25/h4-6,8-20,29H,3,7H2,1-2H3 |
| InChIKey | UFBLBLSLOFCOGM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|