C23H16N2O6S — CID 17361192
ethyl 2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 17361192) has the molecular formula C23H16N2O6S and a molecular weight of 448.46 g/mol. Its IUPAC name is ethyl 2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | ethyl 2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 17361192 |
| Molecular Formula | C23H16N2O6S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | ethyl 2-[4-(4-nitrophenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C(=O)N(c1ccc(Sc3ccc([N+](=O)[O-])cc3)cc1)C2=O |
| InChI | InChI=1S/C23H16N2O6S/c1-2-31-23(28)14-3-12-19-20(13-14)22(27)24(21(19)26)15-4-8-17(9-5-15)32-18-10-6-16(7-11-18)25(29)30/h3-13H,2H2,1H3 |
| InChIKey | MGBOAAKKFSYALA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|