C31H22N2O8 — CID 3500094
[2-(4-nitrophenyl)-2-oxoethyl] 2-[4-(3,4-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3500094) has the molecular formula C31H22N2O8 and a molecular weight of 550.52 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 2-[4-(3,4-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 2-[4-(3,4-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3500094 |
| Molecular Formula | C31H22N2O8 |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 2-[4-(3,4-dimethylphenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)c4ccc(C(=O)OCC(=O)c5ccc([N+](=O)[O-])cc5)cc4C3=O)cc2)cc1C |
| InChI | InChI=1S/C31H22N2O8/c1-18-3-11-25(15-19(18)2)41-24-12-9-22(10-13-24)32-29(35)26-14-6-21(16-27(26)30(32)36)31(37)40-17-28(34)20-4-7-23(8-5-20)33(38)39/h3-16H,17H2,1-2H3 |
| InChIKey | NQUGSIOZZPPQMB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|