C27H21NO7 — CID 126186693
[2-(4-acetyloxyphenyl)-2-oxoethyl] 2-(4-ethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126186693) has the molecular formula C27H21NO7 and a molecular weight of 471.47 g/mol. Its IUPAC name is [2-(4-acetyloxyphenyl)-2-oxoethyl] 2-(4-ethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 2-(4-ethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126186693 |
| Molecular Formula | C27H21NO7 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 2-(4-ethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCc1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)c4ccc(OC(C)=O)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C27H21NO7/c1-3-17-4-9-20(10-5-17)28-25(31)22-13-8-19(14-23(22)26(28)32)27(33)34-15-24(30)18-6-11-21(12-7-18)35-16(2)29/h4-14H,3,15H2,1-2H3 |
| InChIKey | SJFUJHNWSVANBY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|