C17H10NO6- — CID 6920498
2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 6920498) has the molecular formula C17H10NO6- and a molecular weight of 324.27 g/mol. Its IUPAC name is 2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 6920498 |
| Molecular Formula | C17H10NO6- |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)c3ccc(C(=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C17H11NO6/c1-9(19)24-12-5-3-11(4-6-12)18-15(20)13-7-2-10(17(22)23)8-14(13)16(18)21/h2-8H,1H3,(H,22,23)/p-1 |
| InChIKey | GDZHHVABLWIDDM-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|