C32H20N2O7 — CID 1365085
2-(4-acetylphenyl)-5-[2-(4-acetylphenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione (PubChem CID 1365085) has the molecular formula C32H20N2O7 and a molecular weight of 544.52 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-5-[2-(4-acetylphenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-(4-acetylphenyl)-5-[2-(4-acetylphenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 1365085 |
| Molecular Formula | C32H20N2O7 |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 2-(4-acetylphenyl)-5-[2-(4-acetylphenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)c3ccc(Oc4ccc5c(c4)C(=O)N(c4ccc(C(C)=O)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C32H20N2O7/c1-17(35)19-3-7-21(8-4-19)33-29(37)25-13-11-23(15-27(25)31(33)39)41-24-12-14-26-28(16-24)32(40)34(30(26)38)22-9-5-20(6-10-22)18(2)36/h3-16H,1-2H3 |
| InChIKey | RFWDMVRSTGPUSF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|