C37H24N2O7 — CID 59936816
2-methyl-5-[2-[4-[3-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione (PubChem CID 59936816) has the molecular formula C37H24N2O7 and a molecular weight of 608.61 g/mol. Its IUPAC name is 2-methyl-5-[2-[4-[3-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[2-[4-[3-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59936816 |
| Molecular Formula | C37H24N2O7 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | 2-methyl-5-[2-[4-[3-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2cccc(Oc3ccc(N4C(=O)c5ccc(C(=O)c6ccc7c(c6)C(=O)N(C)C7=O)cc5C4=O)cc3)c2)cc1 |
| InChI | InChI=1S/C37H24N2O7/c1-21-6-12-25(13-7-21)45-27-4-3-5-28(20-27)46-26-14-10-24(11-15-26)39-36(43)30-17-9-23(19-32(30)37(39)44)33(40)22-8-16-29-31(18-22)35(42)38(2)34(29)41/h3-20H,1-2H3 |
| InChIKey | ZRCXFRPXYAOIND-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|