C29H16N2O6 — CID 100990572
5-(1,3-dioxoisoindole-5-carbonyl)-2-(4-phenoxyphenyl)isoindole-1,3-dione (PubChem CID 100990572) has the molecular formula C29H16N2O6 and a molecular weight of 488.46 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindole-5-carbonyl)-2-(4-phenoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-(1,3-dioxoisoindole-5-carbonyl)-2-(4-phenoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 100990572 |
| Molecular Formula | C29H16N2O6 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 5-(1,3-dioxoisoindole-5-carbonyl)-2-(4-phenoxyphenyl)isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)NC2=O)c1ccc2c(c1)C(=O)N(c1ccc(Oc3ccccc3)cc1)C2=O |
| InChI | InChI=1S/C29H16N2O6/c32-25(16-6-12-21-23(14-16)27(34)30-26(21)33)17-7-13-22-24(15-17)29(36)31(28(22)35)18-8-10-20(11-9-18)37-19-4-2-1-3-5-19/h1-15H,(H,30,33,34) |
| InChIKey | JQDCSMVDCRCNEJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|