C36H18F2N2O6 — CID 102076477
5-(4-fluorobenzoyl)-2-[4-[5-(4-fluorobenzoyl)-1,3-dioxoisoindol-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 102076477) has the molecular formula C36H18F2N2O6 and a molecular weight of 612.54 g/mol. Its IUPAC name is 5-(4-fluorobenzoyl)-2-[4-[5-(4-fluorobenzoyl)-1,3-dioxoisoindol-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-fluorobenzoyl)-2-[4-[5-(4-fluorobenzoyl)-1,3-dioxoisoindol-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102076477 |
| Molecular Formula | C36H18F2N2O6 |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | 5-(4-fluorobenzoyl)-2-[4-[5-(4-fluorobenzoyl)-1,3-dioxoisoindol-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc(F)cc1)c1ccc2c(c1)C(=O)N(c1ccc(N3C(=O)c4ccc(C(=O)c5ccc(F)cc5)cc4C3=O)cc1)C2=O |
| InChI | InChI=1S/C36H18F2N2O6/c37-23-7-1-19(2-8-23)31(41)21-5-15-27-29(17-21)35(45)39(33(27)43)25-11-13-26(14-12-25)40-34(44)28-16-6-22(18-30(28)36(40)46)32(42)20-3-9-24(38)10-4-20/h1-18H |
| InChIKey | NPMPSFDPVXIHMP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|