C43H32N6O5 — CID 170376519
2-[4-(4-amino-N-methylanilino)phenyl]-5-[2-[4-(4-amino-N-methylanilino)phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione (PubChem CID 170376519) has the molecular formula C43H32N6O5 and a molecular weight of 712.77 g/mol. Its IUPAC name is 2-[4-(4-amino-N-methylanilino)phenyl]-5-[2-[4-(4-amino-N-methylanilino)phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(4-amino-N-methylanilino)phenyl]-5-[2-[4-(4-amino-N-methylanilino)phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170376519 |
| Molecular Formula | C43H32N6O5 |
| Molecular Weight | 712.77 g/mol |
| Exact Mass | 712.24 |
| IUPAC Name | 2-[4-(4-amino-N-methylanilino)phenyl]-5-[2-[4-(4-amino-N-methylanilino)phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
| SMILES | CN(c1ccc(N)cc1)c1ccc(N2C(=O)c3ccc(C(=O)c4ccc5c(c4)C(=O)N(c4ccc(N(C)c6ccc(N)cc6)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C43H32N6O5/c1-46(29-9-5-27(44)6-10-29)31-13-17-33(18-14-31)48-40(51)35-21-3-25(23-37(35)42(48)53)39(50)26-4-22-36-38(24-26)43(54)49(41(36)52)34-19-15-32(16-20-34)47(2)30-11-7-28(45)8-12-30/h3-24H,44-45H2,1-2H3 |
| InChIKey | KXKUDNGUQDENFL-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.77 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|