C15H10N2O4 — CID 18411559
4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 18411559) has the molecular formula C15H10N2O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid.
| Compound Name | 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 18411559 |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid |
| SMILES | Nc1ccc2c(c1)C(=O)N(c1ccc(C(=O)O)cc1)C2=O |
| InChI | InChI=1S/C15H10N2O4/c16-9-3-6-11-12(7-9)14(19)17(13(11)18)10-4-1-8(2-5-10)15(20)21/h1-7H,16H2,(H,20,21) |
| InChIKey | LTQBECZXHMHBIH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|