4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid

C15H10N2O4 — CID 18411559

IUPAC4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid
SMILESNc1ccc2c(c1)C(=O)N(c1ccc(C(=O)O)cc1)C2=O
InChIInChI=1S/C15H10N2O4/c16-9-3-6-11-12(7-9)14(19)17(13(11)18)10-4-1-8(2-5-10)15(20)21/h1-7H,16H2,(H,20,21)
InChIKeyLTQBECZXHMHBIH-UHFFFAOYSA-N
MW282.26 g/mol
LogP1.77
Rot. Bonds2

About 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid

4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 18411559) has the molecular formula C15H10N2O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid.

Molecular Properties

Compound Name4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid
PubChem CID18411559
Molecular FormulaC15H10N2O4
Molecular Weight282.26 g/mol
Exact Mass282.06
IUPAC Name4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid
SMILESNc1ccc2c(c1)C(=O)N(c1ccc(C(=O)O)cc1)C2=O
InChIInChI=1S/C15H10N2O4/c16-9-3-6-11-12(7-9)14(19)17(13(11)18)10-4-1-8(2-5-10)15(20)21/h1-7H,16H2,(H,20,21)
InChIKeyLTQBECZXHMHBIH-UHFFFAOYSA-N
XLogP1.77
TPSA100.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.26
LogP ≤ 51.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid?
The IUPAC name of 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid (CID 18411559) is 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid.
What is the SMILES notation for 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid?
The canonical SMILES for 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid is Nc1ccc2c(c1)C(=O)N(c1ccc(C(=O)O)cc1)C2=O.
What is the InChIKey of 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid?
The InChIKey is LTQBECZXHMHBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O4/c16-9-3-6-11-12(7-9)14(19)17(13(11)18)10-4-1-8(2-5-10)15(20)21/h1-7H,16H2,(H,20,21).
What are the key properties of 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid?
4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid has a molecular weight of 282.26 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-1,3-dioxoisoindol-2-yl)benzoic acid is sourced from PubChem (CID 18411559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).