C33H16N2O13 — CID 2832508
5-[5-[2-(3,5-dicarboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 2832508) has the molecular formula C33H16N2O13 and a molecular weight of 648.49 g/mol. Its IUPAC name is 5-[5-[2-(3,5-dicarboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[2-(3,5-dicarboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 2832508 |
| Molecular Formula | C33H16N2O13 |
| Molecular Weight | 648.49 g/mol |
| Exact Mass | 648.07 |
| IUPAC Name | 5-[5-[2-(3,5-dicarboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2C(=O)c3ccc(C(=O)c4ccc5c(c4)C(=O)N(c4cc(C(=O)O)cc(C(=O)O)c4)C5=O)cc3C2=O)c1 |
| InChI | InChI=1S/C33H16N2O13/c36-25(13-1-3-21-23(11-13)28(39)34(26(21)37)19-7-15(30(41)42)5-16(8-19)31(43)44)14-2-4-22-24(12-14)29(40)35(27(22)38)20-9-17(32(45)46)6-18(10-20)33(47)48/h1-12H,(H,41,42)(H,43,44)(H,45,46)(H,47,48) |
| InChIKey | UFBWRVQEPXTXIJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 241.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|