C31H17N3O8 — CID 101082392
2-[6-(5-carboxy-1,3-dioxoisoindol-2-yl)-9-methylcarbazol-3-yl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 101082392) has the molecular formula C31H17N3O8 and a molecular weight of 559.49 g/mol. Its IUPAC name is 2-[6-(5-carboxy-1,3-dioxoisoindol-2-yl)-9-methylcarbazol-3-yl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[6-(5-carboxy-1,3-dioxoisoindol-2-yl)-9-methylcarbazol-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 101082392 |
| Molecular Formula | C31H17N3O8 |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 2-[6-(5-carboxy-1,3-dioxoisoindol-2-yl)-9-methylcarbazol-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | Cn1c2ccc(N3C(=O)c4ccc(C(=O)O)cc4C3=O)cc2c2cc(N3C(=O)c4ccc(C(=O)O)cc4C3=O)ccc21 |
| InChI | InChI=1S/C31H17N3O8/c1-32-24-8-4-16(33-26(35)18-6-2-14(30(39)40)10-22(18)28(33)37)12-20(24)21-13-17(5-9-25(21)32)34-27(36)19-7-3-15(31(41)42)11-23(19)29(34)38/h2-13H,1H3,(H,39,40)(H,41,42) |
| InChIKey | NUKDNGYYMSBHRR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 154.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|