C17H13NO5 — CID 867582
2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 867582) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 867582 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)O)cc3C2=O)cc1 |
| InChI | InChI=1S/C17H13NO5/c1-2-23-12-6-4-11(5-7-12)18-15(19)13-8-3-10(17(21)22)9-14(13)16(18)20/h3-9H,2H2,1H3,(H,21,22) |
| InChIKey | FZYOJDVYADHXGY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide_misc(2)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|