C23H25N3O5 — CID 27741644
2-(4-ethoxyphenyl)-1,3-dioxo-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]isoindole-5-carboxamide (PubChem CID 27741644) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1,3-dioxo-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]isoindole-5-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-1,3-dioxo-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 27741644 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1,3-dioxo-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]isoindole-5-carboxamide |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)c1ccc2c(c1)C(=O)N(c1ccc(OCC)cc1)C2=O |
| InChI | InChI=1S/C23H25N3O5/c1-4-12-24-20(27)14(3)25-21(28)15-6-11-18-19(13-15)23(30)26(22(18)29)16-7-9-17(10-8-16)31-5-2/h6-11,13-14H,4-5,12H2,1-3H3,(H,24,27)(H,25,28)/t14-/m1/s1 |
| InChIKey | BWORZOORJLKNGQ-CQSZACIVSA-N |
| XLogP | 2.53 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|