C26H23N3O5 — CID 55587486
2-(4-ethoxyphenyl)-N-[[3-(methylcarbamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55587486) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[[3-(methylcarbamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[[3-(methylcarbamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55587486 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[[3-(methylcarbamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)NCc4cccc(C(=O)NC)c4)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H23N3O5/c1-3-34-20-10-8-19(9-11-20)29-25(32)21-12-7-18(14-22(21)26(29)33)24(31)28-15-16-5-4-6-17(13-16)23(30)27-2/h4-14H,3,15H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | ONDFMBPMOQZIES-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|