C26H22N2O6 — CID 24610188
N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 24610188) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 24610188 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-2-(4-ethoxyphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)NC(C)c4ccc5c(c4)OCO5)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H22N2O6/c1-3-32-19-8-6-18(7-9-19)28-25(30)20-10-4-17(12-21(20)26(28)31)24(29)27-15(2)16-5-11-22-23(13-16)34-14-33-22/h4-13,15H,3,14H2,1-2H3,(H,27,29) |
| InChIKey | IXYXWVOUKJIJLW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|