C18H18N2O6 — CID 35065979
N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-ethoxy-3-nitrobenzamide (PubChem CID 35065979) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-ethoxy-3-nitrobenzamide.
| Compound Name | N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-ethoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 35065979 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-4-ethoxy-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)N[C@@H](C)c2ccc3c(c2)OCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N2O6/c1-3-24-15-6-5-13(8-14(15)20(22)23)18(21)19-11(2)12-4-7-16-17(9-12)26-10-25-16/h4-9,11H,3,10H2,1-2H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | CTRUGISWQXGOBI-NSHDSACASA-N |
| XLogP | 3.21 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|