C20H23NO5 — CID 9418967
N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 9418967) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 9418967 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)c2ccc3c(c2)OCO3)cc1OCC |
| InChI | InChI=1S/C20H23NO5/c1-4-23-16-8-6-14(10-18(16)24-5-2)13(3)21-20(22)15-7-9-17-19(11-15)26-12-25-17/h6-11,13H,4-5,12H2,1-3H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | XGBUGLYMRPHOON-ZDUSSCGKSA-N |
| XLogP | 3.70 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |