C21H25NO6 — CID 121132476
N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3,4-diethoxybenzamide (PubChem CID 121132476) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3,4-diethoxybenzamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 121132476 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCCC(O)c2ccc3c(c2)OCO3)cc1OCC |
| InChI | InChI=1S/C21H25NO6/c1-3-25-17-8-6-15(12-19(17)26-4-2)21(24)22-10-9-16(23)14-5-7-18-20(11-14)28-13-27-18/h5-8,11-12,16,23H,3-4,9-10,13H2,1-2H3,(H,22,24) |
| InChIKey | LXLGDNJGIHEYJG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |