C20H19NO6 — CID 121132457
(E)-3-(1,3-benzodioxol-5-yl)-N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]prop-2-enamide (PubChem CID 121132457) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]prop-2-enamide |
|---|---|
| PubChem CID | 121132457 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NCCC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H19NO6/c22-15(14-3-5-17-19(10-14)27-12-25-17)7-8-21-20(23)6-2-13-1-4-16-18(9-13)26-11-24-16/h1-6,9-10,15,22H,7-8,11-12H2,(H,21,23)/b6-2+ |
| InChIKey | BILMQZYQDGBLGZ-QHHAFSJGSA-N |
| XLogP | 2.40 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|