C13H15NO5 — CID 77114116
3-(1,3-benzodioxol-5-yl)-N-(2,3-dihydroxypropyl)prop-2-enamide (PubChem CID 77114116) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(2,3-dihydroxypropyl)prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(2,3-dihydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 77114116 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(2,3-dihydroxypropyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)NCC(O)CO |
| InChI | InChI=1S/C13H15NO5/c15-7-10(16)6-14-13(17)4-2-9-1-3-11-12(5-9)19-8-18-11/h1-5,10,15-16H,6-8H2,(H,14,17) |
| InChIKey | DTDZXEZVHKTMEH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|