C14H17NO6 — CID 107844888
(E)-3-(1,3-benzodioxol-5-yl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]prop-2-enamide (PubChem CID 107844888) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 107844888 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NC(CO)(CO)CO |
| InChI | InChI=1S/C14H17NO6/c16-6-14(7-17,8-18)15-13(19)4-2-10-1-3-11-12(5-10)21-9-20-11/h1-5,16-18H,6-9H2,(H,15,19)/b4-2+ |
| InChIKey | DPMDGNSWVBCMQG-DUXPYHPUSA-N |
| XLogP | -0.74 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|