C14H18N2O3 — CID 55163529
(E)-N-(1-amino-2-methylpropan-2-yl)-3-(1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 55163529) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is (E)-N-(1-amino-2-methylpropan-2-yl)-3-(1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(1-amino-2-methylpropan-2-yl)-3-(1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55163529 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (E)-N-(1-amino-2-methylpropan-2-yl)-3-(1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | CC(C)(CN)NC(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18N2O3/c1-14(2,8-15)16-13(17)6-4-10-3-5-11-12(7-10)19-9-18-11/h3-7H,8-9,15H2,1-2H3,(H,16,17)/b6-4+ |
| InChIKey | WTOROBWEKPFQEE-GQCTYLIASA-N |
| XLogP | 1.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|