C10H9N3O3 — CID 136602077
(E)-3-(1,3-benzodioxol-5-yl)-N-diazenylprop-2-enamide (PubChem CID 136602077) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-diazenylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-diazenylprop-2-enamide |
|---|---|
| PubChem CID | 136602077 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-diazenylprop-2-enamide |
| SMILES | [H]/N=N/NC(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H9N3O3/c11-13-12-10(14)4-2-7-1-3-8-9(5-7)16-6-15-8/h1-5H,6H2,(H2,11,12,14)/b4-2+ |
| InChIKey | HFLSNZQCNDHQME-DUXPYHPUSA-N |
| XLogP | 1.49 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|