C17H14N2O5 — CID 135949815
(E)-3-(1,3-benzodioxol-5-yl)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]prop-2-enamide (PubChem CID 135949815) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]prop-2-enamide |
|---|---|
| PubChem CID | 135949815 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C17H14N2O5/c20-13-4-3-12(14(21)8-13)9-18-19-17(22)6-2-11-1-5-15-16(7-11)24-10-23-15/h1-9,20-21H,10H2,(H,19,22)/b6-2+,18-9+ |
| InChIKey | COKLGVBAHJNUGY-KUYIBZPLSA-N |
| XLogP | 1.99 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|