C19H14N2O4 — CID 45109234
(E)-3-(1,3-benzodioxol-5-yl)-N-[(E)-1-benzofuran-2-ylmethylideneamino]prop-2-enamide (PubChem CID 45109234) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[(E)-1-benzofuran-2-ylmethylideneamino]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(E)-1-benzofuran-2-ylmethylideneamino]prop-2-enamide |
|---|---|
| PubChem CID | 45109234 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[(E)-1-benzofuran-2-ylmethylideneamino]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)N/N=C/c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H14N2O4/c22-19(8-6-13-5-7-17-18(9-13)24-12-23-17)21-20-11-15-10-14-3-1-2-4-16(14)25-15/h1-11H,12H2,(H,21,22)/b8-6+,20-11+ |
| InChIKey | ONSSHJYLBBQYMO-LVBIJHPESA-N |
| XLogP | 3.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|