C26H20N2O5 — CID 16814881
3-[[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-N-(4-methylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 16814881) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is 3-[[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-N-(4-methylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-[[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-N-(4-methylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16814881 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 3-[[(Z)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-N-(4-methylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2oc3ccccc3c2NC(=O)/C=C\c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C26H20N2O5/c1-16-6-10-18(11-7-16)27-26(30)25-24(19-4-2-3-5-20(19)33-25)28-23(29)13-9-17-8-12-21-22(14-17)32-15-31-21/h2-14H,15H2,1H3,(H,27,30)(H,28,29)/b13-9- |
| InChIKey | FCBOHNTYINXHAG-LCYFTJDESA-N |
| XLogP | 5.37 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|