C21H16N2O4 — CID 20875399
3-(furan-2-carbonylamino)-N-(4-methylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 20875399) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-(furan-2-carbonylamino)-N-(4-methylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-(furan-2-carbonylamino)-N-(4-methylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 20875399 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-(furan-2-carbonylamino)-N-(4-methylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2oc3ccccc3c2NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H16N2O4/c1-13-8-10-14(11-9-13)22-21(25)19-18(15-5-2-3-6-16(15)27-19)23-20(24)17-7-4-12-26-17/h2-12H,1H3,(H,22,25)(H,23,24) |
| InChIKey | FZLVIBJCTOQZIN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |