C25H22N2O3 — CID 7501787
N-(4-ethylphenyl)-3-[(4-methylbenzoyl)amino]-1-benzofuran-2-carboxamide (PubChem CID 7501787) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-[(4-methylbenzoyl)amino]-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-ethylphenyl)-3-[(4-methylbenzoyl)amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7501787 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(4-ethylphenyl)-3-[(4-methylbenzoyl)amino]-1-benzofuran-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2oc3ccccc3c2NC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H22N2O3/c1-3-17-10-14-19(15-11-17)26-25(29)23-22(20-6-4-5-7-21(20)30-23)27-24(28)18-12-8-16(2)9-13-18/h4-15H,3H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | BLZJLXSAQJSDSH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |