C26H18N2O5 — CID 16814897
N-[2-[(4-methylphenyl)carbamoyl]-1-benzofuran-3-yl]-2-oxochromene-3-carboxamide (PubChem CID 16814897) has the molecular formula C26H18N2O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)carbamoyl]-1-benzofuran-3-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-[(4-methylphenyl)carbamoyl]-1-benzofuran-3-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 16814897 |
| Molecular Formula | C26H18N2O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[2-[(4-methylphenyl)carbamoyl]-1-benzofuran-3-yl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2oc3ccccc3c2NC(=O)c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C26H18N2O5/c1-15-10-12-17(13-11-15)27-25(30)23-22(18-7-3-5-9-21(18)32-23)28-24(29)19-14-16-6-2-4-8-20(16)33-26(19)31/h2-14H,1H3,(H,27,30)(H,28,29) |
| InChIKey | SGPMHWPBUUODQQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|