C26H18N2O6 — CID 16814409
N-[2-[(3-methoxyphenyl)carbamoyl]-1-benzofuran-3-yl]-2-oxochromene-3-carboxamide (PubChem CID 16814409) has the molecular formula C26H18N2O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is N-[2-[(3-methoxyphenyl)carbamoyl]-1-benzofuran-3-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-[(3-methoxyphenyl)carbamoyl]-1-benzofuran-3-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 16814409 |
| Molecular Formula | C26H18N2O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[2-[(3-methoxyphenyl)carbamoyl]-1-benzofuran-3-yl]-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2oc3ccccc3c2NC(=O)c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C26H18N2O6/c1-32-17-9-6-8-16(14-17)27-25(30)23-22(18-10-3-5-12-21(18)33-23)28-24(29)19-13-15-7-2-4-11-20(15)34-26(19)31/h2-14H,1H3,(H,27,30)(H,28,29) |
| InChIKey | CSIKOIDFDCAOHJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|