C25H22N2O6 — CID 20875154
3-[[2-(3-methoxyphenoxy)acetyl]amino]-N-(3-methoxyphenyl)-1-benzofuran-2-carboxamide (PubChem CID 20875154) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is 3-[[2-(3-methoxyphenoxy)acetyl]amino]-N-(3-methoxyphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-[[2-(3-methoxyphenoxy)acetyl]amino]-N-(3-methoxyphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 20875154 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 3-[[2-(3-methoxyphenoxy)acetyl]amino]-N-(3-methoxyphenyl)-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc(NC(=O)c2oc3ccccc3c2NC(=O)COc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C25H22N2O6/c1-30-17-8-5-7-16(13-17)26-25(29)24-23(20-11-3-4-12-21(20)33-24)27-22(28)15-32-19-10-6-9-18(14-19)31-2/h3-14H,15H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | GCKLQTYIXSKTPQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |