C24H19FN2O4 — CID 7152285
N-(2-fluorophenyl)-3-[[2-(3-methylphenoxy)acetyl]amino]-1-benzofuran-2-carboxamide (PubChem CID 7152285) has the molecular formula C24H19FN2O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[[2-(3-methylphenoxy)acetyl]amino]-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-fluorophenyl)-3-[[2-(3-methylphenoxy)acetyl]amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7152285 |
| Molecular Formula | C24H19FN2O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-(2-fluorophenyl)-3-[[2-(3-methylphenoxy)acetyl]amino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cccc(OCC(=O)Nc2c(C(=O)Nc3ccccc3F)oc3ccccc23)c1 |
| InChI | InChI=1S/C24H19FN2O4/c1-15-7-6-8-16(13-15)30-14-21(28)27-22-17-9-2-5-12-20(17)31-23(22)24(29)26-19-11-4-3-10-18(19)25/h2-13H,14H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | KNAXPYBVVRKEGA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |