C25H22N2O4 — CID 20875380
3-[(4-ethoxybenzoyl)amino]-N-(4-methylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 20875380) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-[(4-ethoxybenzoyl)amino]-N-(4-methylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-[(4-ethoxybenzoyl)amino]-N-(4-methylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 20875380 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-[(4-ethoxybenzoyl)amino]-N-(4-methylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc(C(=O)Nc2c(C(=O)Nc3ccc(C)cc3)oc3ccccc23)cc1 |
| InChI | InChI=1S/C25H22N2O4/c1-3-30-19-14-10-17(11-15-19)24(28)27-22-20-6-4-5-7-21(20)31-23(22)25(29)26-18-12-8-16(2)9-13-18/h4-15H,3H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | HWSBOSFWSLKUDI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |