C20H12BrNO4 — CID 4281017
N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]furan-2-carboxamide (PubChem CID 4281017) has the molecular formula C20H12BrNO4 and a molecular weight of 410.22 g/mol. Its IUPAC name is N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]furan-2-carboxamide.
| Compound Name | N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4281017 |
| Molecular Formula | C20H12BrNO4 |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1c(C(=O)c2ccc(Br)cc2)oc2ccccc12)c1ccco1 |
| InChI | InChI=1S/C20H12BrNO4/c21-13-9-7-12(8-10-13)18(23)19-17(14-4-1-2-5-15(14)26-19)22-20(24)16-6-3-11-25-16/h1-11H,(H,22,24) |
| InChIKey | GYEXKRITMUDRKI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |