C26H20BrCl2NO4 — CID 18848193
N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]-4-butoxy-3,5-dichlorobenzamide (PubChem CID 18848193) has the molecular formula C26H20BrCl2NO4 and a molecular weight of 561.26 g/mol. Its IUPAC name is N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]-4-butoxy-3,5-dichlorobenzamide.
| Compound Name | N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]-4-butoxy-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 18848193 |
| Molecular Formula | C26H20BrCl2NO4 |
| Molecular Weight | 561.26 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]-4-butoxy-3,5-dichlorobenzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2c(C(=O)c3ccc(Br)cc3)oc3ccccc23)cc1Cl |
| InChI | InChI=1S/C26H20BrCl2NO4/c1-2-3-12-33-24-19(28)13-16(14-20(24)29)26(32)30-22-18-6-4-5-7-21(18)34-25(22)23(31)15-8-10-17(27)11-9-15/h4-11,13-14H,2-3,12H2,1H3,(H,30,32) |
| InChIKey | VUPCNYJOSTVBJL-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.26 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|