C27H24ClNO5 — CID 18848018
3-butoxy-N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]benzamide (PubChem CID 18848018) has the molecular formula C27H24ClNO5 and a molecular weight of 477.94 g/mol. Its IUPAC name is 3-butoxy-N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]benzamide.
| Compound Name | 3-butoxy-N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 18848018 |
| Molecular Formula | C27H24ClNO5 |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 3-butoxy-N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2c(C(=O)c3ccc(OC)c(Cl)c3)oc3ccccc23)c1 |
| InChI | InChI=1S/C27H24ClNO5/c1-3-4-14-33-19-9-7-8-18(15-19)27(31)29-24-20-10-5-6-11-22(20)34-26(24)25(30)17-12-13-23(32-2)21(28)16-17/h5-13,15-16H,3-4,14H2,1-2H3,(H,29,31) |
| InChIKey | AYWKOOOCEUHLLJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|